C29H28F7NO3 — CID 21099314
3-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-hydroxycyclopent-2-en-1-one (PubChem CID 21099314) has the molecular formula C29H28F7NO3 and a molecular weight of 571.53 g/mol. Its IUPAC name is 3-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-hydroxycyclopent-2-en-1-one.
| Compound Name | 3-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 21099314 |
| Molecular Formula | C29H28F7NO3 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 3-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-hydroxycyclopent-2-en-1-one |
| SMILES | CC(OC1CCC2CN(C3=CC(=O)CC3O)CC2C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H28F7NO3/c1-15(18-8-19(28(31,32)33)10-20(9-18)29(34,35)36)40-26-7-4-17-13-37(24-11-22(38)12-25(24)39)14-23(17)27(26)16-2-5-21(30)6-3-16/h2-3,5-6,8-11,15,17,23,25-27,39H,4,7,12-14H2,1H3 |
| InChIKey | SDSXOODCBQJSNM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |