C29H30F7NO3 — CID 91219366
3-[[(1S,2R,3R,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexyl]methylimino]cyclopentan-1-one (PubChem CID 91219366) has the molecular formula C29H30F7NO3 and a molecular weight of 573.55 g/mol. Its IUPAC name is 3-[[(1S,2R,3R,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexyl]methylimino]cyclopentan-1-one.
| Compound Name | 3-[[(1S,2R,3R,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexyl]methylimino]cyclopentan-1-one |
|---|---|
| PubChem CID | 91219366 |
| Molecular Formula | C29H30F7NO3 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 3-[[(1S,2R,3R,6S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-6-(hydroxymethyl)cyclohexyl]methylimino]cyclopentan-1-one |
| SMILES | C[C@@H](O[C@@H]1CC[C@H](CO)[C@H](C/N=C2/CCC(=O)C2)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F7NO3/c1-16(19-10-20(28(31,32)33)12-21(11-19)29(34,35)36)40-26-9-4-18(15-38)25(14-37-23-7-8-24(39)13-23)27(26)17-2-5-22(30)6-3-17/h2-3,5-6,10-12,16,18,25-27,38H,4,7-9,13-15H2,1H3/b37-23-/t16-,18-,25+,26-,27+/m1/s1 |
| InChIKey | RMOXKASEPGDHHJ-BHUWFMIDSA-N |
| XLogP | 7.31 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|