C22H19F6N3O2 — CID 139985135
3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylcyclopentane-1-carbonyl azide (PubChem CID 139985135) has the molecular formula C22H19F6N3O2 and a molecular weight of 471.40 g/mol. Its IUPAC name is 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylcyclopentane-1-carbonyl azide.
| Compound Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylcyclopentane-1-carbonyl azide |
|---|---|
| PubChem CID | 139985135 |
| Molecular Formula | C22H19F6N3O2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylcyclopentane-1-carbonyl azide |
| SMILES | CC(OC1CCC(C(=O)N=[N+]=[N-])C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F6N3O2/c1-12(14-9-15(21(23,24)25)11-16(10-14)22(26,27)28)33-18-8-7-17(20(32)30-31-29)19(18)13-5-3-2-4-6-13/h2-6,9-12,17-19H,7-8H2,1H3 |
| InChIKey | CNCPGUIQIHOHGL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|