C22H18F6O3 — CID 87973258
(3R,4S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-methylidene-4-phenyloxan-2-one (PubChem CID 87973258) has the molecular formula C22H18F6O3 and a molecular weight of 444.37 g/mol. Its IUPAC name is (3R,4S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-methylidene-4-phenyloxan-2-one.
| Compound Name | (3R,4S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-methylidene-4-phenyloxan-2-one |
|---|---|
| PubChem CID | 87973258 |
| Molecular Formula | C22H18F6O3 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (3R,4S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-methylidene-4-phenyloxan-2-one |
| SMILES | C=C1COC(=O)[C@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C22H18F6O3/c1-12-11-30-20(29)19(18(12)14-6-4-3-5-7-14)31-13(2)15-8-16(21(23,24)25)10-17(9-15)22(26,27)28/h3-10,13,18-19H,1,11H2,2H3/t13-,18?,19-/m1/s1 |
| InChIKey | GUYPYRZYTRDEGI-MALVVIPZSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|