C22H19F6NO3 — CID 57130745
(2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-isocyanato-3-phenyloxane (PubChem CID 57130745) has the molecular formula C22H19F6NO3 and a molecular weight of 459.39 g/mol. Its IUPAC name is (2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-isocyanato-3-phenyloxane.
| Compound Name | (2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-isocyanato-3-phenyloxane |
|---|---|
| PubChem CID | 57130745 |
| Molecular Formula | C22H19F6NO3 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-isocyanato-3-phenyloxane |
| SMILES | CC(O[C@H]1OCC[C@@H](N=C=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F6NO3/c1-13(15-9-16(21(23,24)25)11-17(10-15)22(26,27)28)32-20-19(14-5-3-2-4-6-14)18(29-12-30)7-8-31-20/h2-6,9-11,13,18-20H,7-8H2,1H3/t13?,18-,19?,20-/m1/s1 |
| InChIKey | JTMHIDQXBQCIBS-TVNWGBCFSA-N |
| XLogP | 6.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|