C22H21F6N3O2 — CID 85046351
4-(azidomethyl)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxane (PubChem CID 85046351) has the molecular formula C22H21F6N3O2 and a molecular weight of 473.42 g/mol. Its IUPAC name is 4-(azidomethyl)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxane.
| Compound Name | 4-(azidomethyl)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxane |
|---|---|
| PubChem CID | 85046351 |
| Molecular Formula | C22H21F6N3O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-(azidomethyl)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxane |
| SMILES | CC(OC1OCCC(CN=[N+]=[N-])C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F6N3O2/c1-13(16-9-17(21(23,24)25)11-18(10-16)22(26,27)28)33-20-19(14-5-3-2-4-6-14)15(7-8-32-20)12-30-31-29/h2-6,9-11,13,15,19-20H,7-8,12H2,1H3 |
| InChIKey | MVWUVSPVQIYJGP-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|