C22H20F6O3 — CID 87972688
(3R,4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxane-3-carbaldehyde (PubChem CID 87972688) has the molecular formula C22H20F6O3 and a molecular weight of 446.39 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxane-3-carbaldehyde.
| Compound Name | (3R,4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxane-3-carbaldehyde |
|---|---|
| PubChem CID | 87972688 |
| Molecular Formula | C22H20F6O3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (3R,4R,5S)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxane-3-carbaldehyde |
| SMILES | C[C@@H](O[C@@H]1COC[C@H](C=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F6O3/c1-13(15-7-17(21(23,24)25)9-18(8-15)22(26,27)28)31-19-12-30-11-16(10-29)20(19)14-5-3-2-4-6-14/h2-10,13,16,19-20H,11-12H2,1H3/t13-,16+,19-,20?/m1/s1 |
| InChIKey | BDAMECWFFFLYRY-BZYBTNJISA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|