C30H35F6NO4 — CID 163903753
tert-butyl (3aR,4R,5S)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 163903753) has the molecular formula C30H35F6NO4 and a molecular weight of 587.60 g/mol. Its IUPAC name is tert-butyl (3aR,4R,5S)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,5S)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 163903753 |
| Molecular Formula | C30H35F6NO4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | tert-butyl (3aR,4R,5S)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | Cc1ccccc1[C@@H]1[C@@H](O[C@H](CO)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC2CN(C(=O)OC(C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C30H35F6NO4/c1-17-7-5-6-8-22(17)26-23-15-37(27(39)41-28(2,3)4)14-18(23)9-10-24(26)40-25(16-38)19-11-20(29(31,32)33)13-21(12-19)30(34,35)36/h5-8,11-13,18,23-26,38H,9-10,14-16H2,1-4H3/t18?,23-,24+,25-,26+/m1/s1 |
| InChIKey | QMCMSQSLQJVPQZ-GEOBFDFRSA-N |
| XLogP | 7.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |