C30H35F6NO4 — CID 87144184
(3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-1-tert-butyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (PubChem CID 87144184) has the molecular formula C30H35F6NO4 and a molecular weight of 587.60 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-1-tert-butyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.
| Compound Name | (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-1-tert-butyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 87144184 |
| Molecular Formula | C30H35F6NO4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (3aR,4R,5S,7aS)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-1-tert-butyl-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)O)C(C(C)(C)C)[C@H]2CC[C@@H]1O[C@@H](CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H35F6NO4/c1-16-7-5-6-8-20(16)25-22-14-37(27(39)40)26(28(2,3)4)21(22)9-10-23(25)41-24(15-38)17-11-18(29(31,32)33)13-19(12-17)30(34,35)36/h5-8,11-13,21-26,38H,9-10,14-15H2,1-4H3,(H,39,40)/t21-,22+,23-,24-,25-,26?/m0/s1 |
| InChIKey | XSHJVPLJZVNOSI-ARIDHXCHSA-N |
| XLogP | 7.67 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |