C29H30F7NO3 — CID 87849100
(3aS,4S,5R,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1-tert-butyl-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (PubChem CID 87849100) has the molecular formula C29H30F7NO3 and a molecular weight of 573.55 g/mol. Its IUPAC name is (3aS,4S,5R,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1-tert-butyl-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.
| Compound Name | (3aS,4S,5R,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1-tert-butyl-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 87849100 |
| Molecular Formula | C29H30F7NO3 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (3aS,4S,5R,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-1-tert-butyl-4-(4-fluorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
| SMILES | C=C(O[C@@H]1CC[C@@H]2C(C(C)(C)C)N(C(=O)O)C[C@@H]2[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F7NO3/c1-15(17-11-18(28(31,32)33)13-19(12-17)29(34,35)36)40-23-10-9-21-22(24(23)16-5-7-20(30)8-6-16)14-37(26(38)39)25(21)27(2,3)4/h5-8,11-13,21-25H,1,9-10,14H2,2-4H3,(H,38,39)/t21-,22-,23+,24+,25?/m0/s1 |
| InChIKey | ACKARRRSRWNUFJ-ILRLDQMXSA-N |
| XLogP | 8.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|