C32H37F6NO5 — CID 71763879
tert-butyl (3aR,4R,5S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]-2-ethoxy-2-oxoethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 71763879) has the molecular formula C32H37F6NO5 and a molecular weight of 629.64 g/mol. Its IUPAC name is tert-butyl (3aR,4R,5S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]-2-ethoxy-2-oxoethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,5S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]-2-ethoxy-2-oxoethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 71763879 |
| Molecular Formula | C32H37F6NO5 |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | tert-butyl (3aR,4R,5S,7aS)-5-[1-[3,5-bis(trifluoromethyl)phenyl]-2-ethoxy-2-oxoethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | CCOC(=O)C(O[C@H]1CC[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2[C@@H]1c1ccccc1C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H37F6NO5/c1-6-42-28(40)27(20-13-21(31(33,34)35)15-22(14-20)32(36,37)38)43-25-12-11-19-16-39(29(41)44-30(3,4)5)17-24(19)26(25)23-10-8-7-9-18(23)2/h7-10,13-15,19,24-27H,6,11-12,16-17H2,1-5H3/t19-,24-,25+,26+,27?/m1/s1 |
| InChIKey | JCYGHNVXENNDLU-WKFVTGRVSA-N |
| XLogP | 8.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |