C31H31F6NO2 — CID 87488858
(3aS,7R,7aR)-2-benzyl-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 87488858) has the molecular formula C31H31F6NO2 and a molecular weight of 563.58 g/mol. Its IUPAC name is (3aS,7R,7aR)-2-benzyl-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | (3aS,7R,7aR)-2-benzyl-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 87488858 |
| Molecular Formula | C31H31F6NO2 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (3aS,7R,7aR)-2-benzyl-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | Cc1ccccc1[C@@H]1C(O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC[C@@H]2CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C31H31F6NO2/c1-19-8-6-7-11-26(19)28-27-17-38(15-21-9-4-3-5-10-21)16-23(27)18-39-29(28)40-20(2)22-12-24(30(32,33)34)14-25(13-22)31(35,36)37/h3-14,20,23,27-29H,15-18H2,1-2H3/t20-,23+,27-,28+,29?/m1/s1 |
| InChIKey | WTWSGZCBRGUNOV-RMDRJERPSA-N |
| XLogP | 8.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |