C28H31F6N3O2 — CID 89037887
(3aS)-2-acetyl-N-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxamide (PubChem CID 89037887) has the molecular formula C28H31F6N3O2 and a molecular weight of 555.56 g/mol. Its IUPAC name is (3aS)-2-acetyl-N-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxamide.
| Compound Name | (3aS)-2-acetyl-N-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 89037887 |
| Molecular Formula | C28H31F6N3O2 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (3aS)-2-acetyl-N-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxamide |
| SMILES | CC(=O)N1CC2CCN(C(=O)N(C)C(C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(c3ccccc3C)[C@@H]2C1 |
| InChI | InChI=1S/C28H31F6N3O2/c1-16-7-5-6-8-23(16)25-24-15-36(18(3)38)14-19(24)9-10-37(25)26(39)35(4)17(2)20-11-21(27(29,30)31)13-22(12-20)28(32,33)34/h5-8,11-13,17,19,24-25H,9-10,14-15H2,1-4H3/t17?,19?,24-,25?/m1/s1 |
| InChIKey | IMZQVWAZTJVJNJ-GOKIKPAPSA-N |
| XLogP | 6.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |