C27H30F6N4O2 — CID 25171009
(3aS,4R)-5-N-[1-[2,4-bis(trifluoromethyl)phenyl]ethyl]-5-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2,5-dicarboxamide (PubChem CID 25171009) has the molecular formula C27H30F6N4O2 and a molecular weight of 556.55 g/mol. Its IUPAC name is (3aS,4R)-5-N-[1-[2,4-bis(trifluoromethyl)phenyl]ethyl]-5-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2,5-dicarboxamide.
| Compound Name | (3aS,4R)-5-N-[1-[2,4-bis(trifluoromethyl)phenyl]ethyl]-5-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 25171009 |
| Molecular Formula | C27H30F6N4O2 |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (3aS,4R)-5-N-[1-[2,4-bis(trifluoromethyl)phenyl]ethyl]-5-N-methyl-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2,5-dicarboxamide |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(N)=O)CC2CCN1C(=O)N(C)C(C)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C27H30F6N4O2/c1-15-6-4-5-7-19(15)23-21-14-36(24(34)38)13-17(21)10-11-37(23)25(39)35(3)16(2)20-9-8-18(26(28,29)30)12-22(20)27(31,32)33/h4-9,12,16-17,21,23H,10-11,13-14H2,1-3H3,(H2,34,38)/t16?,17?,21-,23+/m1/s1 |
| InChIKey | YZKGRSUNZKYRSI-YBWWRTOPSA-N |
| XLogP | 6.22 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |