C21H28FNO5 — CID 96519651
tert-butyl (3aS,4R,6aR)-4-[2-(3-fluoro-4-methoxyphenyl)acetyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 96519651) has the molecular formula C21H28FNO5 and a molecular weight of 393.46 g/mol. Its IUPAC name is tert-butyl (3aS,4R,6aR)-4-[2-(3-fluoro-4-methoxyphenyl)acetyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,4R,6aR)-4-[2-(3-fluoro-4-methoxyphenyl)acetyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 96519651 |
| Molecular Formula | C21H28FNO5 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | tert-butyl (3aS,4R,6aR)-4-[2-(3-fluoro-4-methoxyphenyl)acetyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | COc1ccc(CC(=O)O[C@@H]2CC[C@H]3CN(C(=O)OC(C)(C)C)C[C@H]32)cc1F |
| InChI | InChI=1S/C21H28FNO5/c1-21(2,3)28-20(25)23-11-14-6-8-17(15(14)12-23)27-19(24)10-13-5-7-18(26-4)16(22)9-13/h5,7,9,14-15,17H,6,8,10-12H2,1-4H3/t14-,15+,17+/m0/s1 |
| InChIKey | NXAUULDUBRWCCS-ZMSDIMECSA-N |
| XLogP | 3.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |