C32H25F5N6O6 — CID 140509205
[2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(pyridin-3-ylmethylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140509205) has the molecular formula C32H25F5N6O6 and a molecular weight of 684.58 g/mol. Its IUPAC name is [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(pyridin-3-ylmethylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(pyridin-3-ylmethylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140509205 |
| Molecular Formula | C32H25F5N6O6 |
| Molecular Weight | 684.58 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(pyridin-3-ylmethylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)NCc2cccnc2)c(OC(=O)C(F)(F)F)c1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C32H25F5N6O6/c1-16-7-8-20(29(47)39-13-17-4-3-11-38-12-17)27(49-30(48)32(35,36)37)24(16)25-19-9-10-23(46)43(26-21(33)5-2-6-22(26)34)28(19)42-31(41-25)40-18(14-44)15-45/h2-12,18,44-45H,13-15H2,1H3,(H,39,47)(H,40,41,42) |
| InChIKey | HHUIGIROBAVRGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|