C32H28F5N7O4 — CID 140509229
[3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-2-methyl-6-(phenylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140509229) has the molecular formula C32H28F5N7O4 and a molecular weight of 669.61 g/mol. Its IUPAC name is [3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-2-methyl-6-(phenylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-2-methyl-6-(phenylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140509229 |
| Molecular Formula | C32H28F5N7O4 |
| Molecular Weight | 669.61 g/mol |
| Exact Mass | 669.21 |
| IUPAC Name | [3-[8-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-2-methyl-6-(phenylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1c(-c2nc(NCCN(C)C)nc3c2CNC(=O)N3c2c(F)cccc2F)ccc(C(=O)Nc2ccccc2)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C32H28F5N7O4/c1-17-19(12-13-20(26(17)48-29(46)32(35,36)37)28(45)40-18-8-5-4-6-9-18)24-21-16-39-31(47)44(25-22(33)10-7-11-23(25)34)27(21)42-30(41-24)38-14-15-43(2)3/h4-13H,14-16H2,1-3H3,(H,39,47)(H,40,45)(H,38,41,42) |
| InChIKey | BELIHQRJHHUGIP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|