C30H26F5N7O4S — CID 140509233
[2-[8-(2,6-difluorophenyl)-2-(2,2-dimethylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(1,3-thiazol-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140509233) has the molecular formula C30H26F5N7O4S and a molecular weight of 675.64 g/mol. Its IUPAC name is [2-[8-(2,6-difluorophenyl)-2-(2,2-dimethylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(1,3-thiazol-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[8-(2,6-difluorophenyl)-2-(2,2-dimethylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(1,3-thiazol-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140509233 |
| Molecular Formula | C30H26F5N7O4S |
| Molecular Weight | 675.64 g/mol |
| Exact Mass | 675.17 |
| IUPAC Name | [2-[8-(2,6-difluorophenyl)-2-(2,2-dimethylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(1,3-thiazol-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)Nc2nccs2)c(OC(=O)C(F)(F)F)c1-c1nc(NCC(C)(C)C)nc2c1CNC(=O)N2c1c(F)cccc1F |
| InChI | InChI=1S/C30H26F5N7O4S/c1-14-8-9-15(24(43)41-27-36-10-11-47-27)22(46-25(44)30(33,34)35)19(14)20-16-12-37-28(45)42(21-17(31)6-5-7-18(21)32)23(16)40-26(39-20)38-13-29(2,3)4/h5-11H,12-13H2,1-4H3,(H,37,45)(H,36,41,43)(H,38,39,40) |
| InChIKey | JPNDEMXPWQNIKT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|