C30H58O8P2 — CID 140510025
1,4-bis[diethoxyphosphoryl-(4-methoxycyclohexyl)methyl]cyclohexane (PubChem CID 140510025) has the molecular formula C30H58O8P2 and a molecular weight of 608.73 g/mol. Its IUPAC name is 1,4-bis[diethoxyphosphoryl-(4-methoxycyclohexyl)methyl]cyclohexane.
| Compound Name | 1,4-bis[diethoxyphosphoryl-(4-methoxycyclohexyl)methyl]cyclohexane |
|---|---|
| PubChem CID | 140510025 |
| Molecular Formula | C30H58O8P2 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | 1,4-bis[diethoxyphosphoryl-(4-methoxycyclohexyl)methyl]cyclohexane |
| SMILES | CCOP(=O)(OCC)C(C1CCC(OC)CC1)C1CCC(C(C2CCC(OC)CC2)P(=O)(OCC)OCC)CC1 |
| InChI | InChI=1S/C30H58O8P2/c1-7-35-39(31,36-8-2)29(25-15-19-27(33-5)20-16-25)23-11-13-24(14-12-23)30(40(32,37-9-3)38-10-4)26-17-21-28(34-6)22-18-26/h23-30H,7-22H2,1-6H3 |
| InChIKey | PVTLBONHVYDXPK-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|