C25H32N2O3 — CID 140510148
ethyl 1-benzyl-4-[2-(2-methylphenyl)propanoylamino]piperidine-2-carboxylate (PubChem CID 140510148) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[2-(2-methylphenyl)propanoylamino]piperidine-2-carboxylate.
| Compound Name | ethyl 1-benzyl-4-[2-(2-methylphenyl)propanoylamino]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 140510148 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | ethyl 1-benzyl-4-[2-(2-methylphenyl)propanoylamino]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC(NC(=O)C(C)c2ccccc2C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C25H32N2O3/c1-4-30-25(29)23-16-21(14-15-27(23)17-20-11-6-5-7-12-20)26-24(28)19(3)22-13-9-8-10-18(22)2/h5-13,19,21,23H,4,14-17H2,1-3H3,(H,26,28) |
| InChIKey | NLHVMEUOKPXORZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |