C14H17N5O4 — CID 140510422
(2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6,7,10,11,12-pentazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)oxolane-3,4-diol (PubChem CID 140510422) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6,7,10,11,12-pentazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6,7,10,11,12-pentazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 140510422 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6,7,10,11,12-pentazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)oxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc2ccc3[nH][nH]ncc(n1)c23 |
| InChI | InChI=1S/C14H17N5O4/c1-14(22)12(21)10(6-20)23-13(14)19-5-7-2-3-8-11(7)9(17-19)4-15-18-16-8/h2-5,10,12-13,16,18,20-22H,6H2,1H3/t10-,12-,13-,14-/m1/s1 |
| InChIKey | KFVPJLKRSQJILU-FMKGYKFTSA-N |
| XLogP | -0.20 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |