C8H8N4O2 — CID 140513842
N-(6-methoxy-3-pyridinyl)-1,3,4-oxadiazol-2-amine (PubChem CID 140513842) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(6-methoxy-3-pyridinyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 140513842 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COc1ccc(Nc2nnco2)cn1 |
| InChI | InChI=1S/C8H8N4O2/c1-13-7-3-2-6(4-9-7)11-8-12-10-5-14-8/h2-5H,1H3,(H,11,12) |
| InChIKey | CRBYFNTXISKZPU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |