C13H10FN3OS — CID 79143632
6-fluoro-N-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine (PubChem CID 79143632) has the molecular formula C13H10FN3OS and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-fluoro-N-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79143632 |
| Molecular Formula | C13H10FN3OS |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-fluoro-N-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(Nc2nc3ccc(F)cc3s2)cn1 |
| InChI | InChI=1S/C13H10FN3OS/c1-18-12-5-3-9(7-15-12)16-13-17-10-4-2-8(14)6-11(10)19-13/h2-7H,1H3,(H,16,17) |
| InChIKey | WZCNHCRPQLHFTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |