C12H8FN3S — CID 79144359
6-fluoro-N-pyridin-3-yl-1,3-benzothiazol-2-amine (PubChem CID 79144359) has the molecular formula C12H8FN3S and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-fluoro-N-pyridin-3-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-pyridin-3-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79144359 |
| Molecular Formula | C12H8FN3S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 6-fluoro-N-pyridin-3-yl-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2nc(Nc3cccnc3)sc2c1 |
| InChI | InChI=1S/C12H8FN3S/c13-8-3-4-10-11(6-8)17-12(16-10)15-9-2-1-5-14-7-9/h1-7H,(H,15,16) |
| InChIKey | FWWVPTBCLYGRBM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |