C17H29Br — CID 140513997
2-(bromomethyl)-7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 140513997) has the molecular formula C17H29Br and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-(bromomethyl)-7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(bromomethyl)-7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 140513997 |
| Molecular Formula | C17H29Br |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(bromomethyl)-7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | BrCC1CCC2CCC(C3CCCCC3)CC2C1 |
| InChI | InChI=1S/C17H29Br/c18-12-13-6-7-15-8-9-16(11-17(15)10-13)14-4-2-1-3-5-14/h13-17H,1-12H2 |
| InChIKey | NZLRNBJPIXEKIM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|