C20H34O2 — CID 140513988
3-(7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpropanoic acid (PubChem CID 140513988) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-(7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpropanoic acid.
| Compound Name | 3-(7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 140513988 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3-(7-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methylpropanoic acid |
| SMILES | CC(CC1CCC2CCC(C3CCCCC3)CC2C1)C(=O)O |
| InChI | InChI=1S/C20H34O2/c1-14(20(21)22)11-15-7-8-17-9-10-18(13-19(17)12-15)16-5-3-2-4-6-16/h14-19H,2-13H2,1H3,(H,21,22) |
| InChIKey | QQUFURKOPVTDNX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |