C16H31N — CID 168896176
1-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)propan-2-yl]aziridine;ethane (PubChem CID 168896176) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 1-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)propan-2-yl]aziridine;ethane.
| Compound Name | 1-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)propan-2-yl]aziridine;ethane |
|---|---|
| PubChem CID | 168896176 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 1-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)propan-2-yl]aziridine;ethane |
| SMILES | CC.CC(CC1CCC2CCCC2C1)N1CC1 |
| InChI | InChI=1S/C14H25N.C2H6/c1-11(15-7-8-15)9-12-5-6-13-3-2-4-14(13)10-12;1-2/h11-14H,2-10H2,1H3;1-2H3 |
| InChIKey | YKUTUTWGEHQIPJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|