C19H32O2 — CID 157040286
5-(1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-2-yl)pentanoic acid (PubChem CID 157040286) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-2-yl)pentanoic acid.
| Compound Name | 5-(1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 157040286 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 5-(1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-2-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1CCC2CC3CCCCC3CC2C1 |
| InChI | InChI=1S/C19H32O2/c20-19(21)8-4-1-5-14-9-10-17-12-15-6-2-3-7-16(15)13-18(17)11-14/h14-18H,1-13H2,(H,20,21) |
| InChIKey | SHLYFYXNJFVXER-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|