C18H31NO2 — CID 140515362
methyl 2-cyclohexyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylate (PubChem CID 140515362) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is methyl 2-cyclohexyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylate.
| Compound Name | methyl 2-cyclohexyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 140515362 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | methyl 2-cyclohexyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylate |
| SMILES | COC(=O)C1C(C)C(C2CCCCC2)NC2CCCCC21 |
| InChI | InChI=1S/C18H31NO2/c1-12-16(18(20)21-2)14-10-6-7-11-15(14)19-17(12)13-8-4-3-5-9-13/h12-17,19H,3-11H2,1-2H3 |
| InChIKey | GRLDHKXBYHJZOQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |