C8H12Mg — CID 140515591
magnesium;cyclopenta-1,3-diene;propane (PubChem CID 140515591) has the molecular formula C8H12Mg and a molecular weight of 132.49 g/mol. Its IUPAC name is magnesium;cyclopenta-1,3-diene;propane.
| Compound Name | magnesium;cyclopenta-1,3-diene;propane |
|---|---|
| PubChem CID | 140515591 |
| Molecular Formula | C8H12Mg |
| Molecular Weight | 132.49 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | magnesium;cyclopenta-1,3-diene;propane |
| SMILES | [C-]1=CC=CC1.[CH2-]CC.[Mg+2] |
| InChI | InChI=1S/C5H5.C3H7.Mg/c1-2-4-5-3-1;1-3-2;/h1-3H,4H2;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | AXNOMWAYOVRKEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|