C24H42N6O2 — CID 140515752
N-(3-imidazol-1-ylpropyl)-4-[[5-(4-methoxycyclohexyl)-1,3-diazinan-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 140515752) has the molecular formula C24H42N6O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-[[5-(4-methoxycyclohexyl)-1,3-diazinan-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-[[5-(4-methoxycyclohexyl)-1,3-diazinan-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140515752 |
| Molecular Formula | C24H42N6O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-[[5-(4-methoxycyclohexyl)-1,3-diazinan-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | COC1CCC(C2CNC(NC3CCC(C(=O)NCCCn4ccnc4)CC3)NC2)CC1 |
| InChI | InChI=1S/C24H42N6O2/c1-32-22-9-5-18(6-10-22)20-15-27-24(28-16-20)29-21-7-3-19(4-8-21)23(31)26-11-2-13-30-14-12-25-17-30/h12,14,17-22,24,27-29H,2-11,13,15-16H2,1H3,(H,26,31) |
| InChIKey | OTGPYMPEVDKNLD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|