C21H29N5O3 — CID 155918395
(1S,3R,4R)-N-(3-imidazol-1-ylpropyl)-4-methoxy-3-[(2-pyridin-3-ylacetyl)amino]cyclohexane-1-carboxamide (PubChem CID 155918395) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is (1S,3R,4R)-N-(3-imidazol-1-ylpropyl)-4-methoxy-3-[(2-pyridin-3-ylacetyl)amino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-N-(3-imidazol-1-ylpropyl)-4-methoxy-3-[(2-pyridin-3-ylacetyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155918395 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (1S,3R,4R)-N-(3-imidazol-1-ylpropyl)-4-methoxy-3-[(2-pyridin-3-ylacetyl)amino]cyclohexane-1-carboxamide |
| SMILES | CO[C@@H]1CC[C@H](C(=O)NCCCn2ccnc2)C[C@H]1NC(=O)Cc1cccnc1 |
| InChI | InChI=1S/C21H29N5O3/c1-29-19-6-5-17(21(28)24-8-3-10-26-11-9-23-15-26)13-18(19)25-20(27)12-16-4-2-7-22-14-16/h2,4,7,9,11,14-15,17-19H,3,5-6,8,10,12-13H2,1H3,(H,24,28)(H,25,27)/t17-,18+,19+/m0/s1 |
| InChIKey | ZYRYCUSSJWBLGZ-IPMKNSEASA-N |
| XLogP | 1.33 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|