C16H20N4O2S — CID 95739107
(2S)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 95739107) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is (2S)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95739107 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2S)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)[C@@H]1CCC(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C16H20N4O2S/c21-15-5-4-14(20(15)11-13-3-1-10-23-13)16(22)18-6-2-8-19-9-7-17-12-19/h1,3,7,9-10,12,14H,2,4-6,8,11H2,(H,18,22)/t14-/m0/s1 |
| InChIKey | RVFWOEAPFKHERE-AWEZNQCLSA-N |
| XLogP | 1.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|