C19H21N5O2S — CID 91947685
5-oxo-1-(thiophen-2-ylmethyl)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyrrolidine-2-carboxamide (PubChem CID 91947685) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 5-oxo-1-(thiophen-2-ylmethyl)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-1-(thiophen-2-ylmethyl)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91947685 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-oxo-1-(thiophen-2-ylmethyl)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCc1nnc2ccccn12)C1CCC(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C19H21N5O2S/c25-18-9-8-15(24(18)13-14-5-4-12-27-14)19(26)20-10-3-7-17-22-21-16-6-1-2-11-23(16)17/h1-2,4-6,11-12,15H,3,7-10,13H2,(H,20,26) |
| InChIKey | REDXFWNAWBJGRH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|