C14H24N4O2 — CID 155508081
(1S,3R,4R)-3-amino-4-methoxy-N-(3-pyrazol-1-ylpropyl)cyclohexane-1-carboxamide (PubChem CID 155508081) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-4-methoxy-N-(3-pyrazol-1-ylpropyl)cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-3-amino-4-methoxy-N-(3-pyrazol-1-ylpropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155508081 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1S,3R,4R)-3-amino-4-methoxy-N-(3-pyrazol-1-ylpropyl)cyclohexane-1-carboxamide |
| SMILES | CO[C@@H]1CC[C@H](C(=O)NCCCn2cccn2)C[C@H]1N |
| InChI | InChI=1S/C14H24N4O2/c1-20-13-5-4-11(10-12(13)15)14(19)16-6-2-8-18-9-3-7-17-18/h3,7,9,11-13H,2,4-6,8,10,15H2,1H3,(H,16,19)/t11-,12+,13+/m0/s1 |
| InChIKey | ORQVZRMGVALDFI-YNEHKIRRSA-N |
| XLogP | 0.53 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|