C26H30N4O4 — CID 55596931
1,2-bis(4-methoxyphenyl)-6-oxo-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 55596931) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-6-oxo-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 1,2-bis(4-methoxyphenyl)-6-oxo-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55596931 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-6-oxo-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)NCCCn3cccn3)CCC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O4/c1-33-21-9-5-19(6-10-21)25-23(26(32)27-15-3-17-29-18-4-16-28-29)13-14-24(31)30(25)20-7-11-22(34-2)12-8-20/h4-12,16,18,23,25H,3,13-15,17H2,1-2H3,(H,27,32) |
| InChIKey | NWYHTURTGHBTKQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|