C31H36FN3O3 — CID 124766985
(2R,3R)-N-[3-[benzyl(ethyl)amino]propyl]-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 124766985) has the molecular formula C31H36FN3O3 and a molecular weight of 517.65 g/mol. Its IUPAC name is (2R,3R)-N-[3-[benzyl(ethyl)amino]propyl]-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (2R,3R)-N-[3-[benzyl(ethyl)amino]propyl]-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 124766985 |
| Molecular Formula | C31H36FN3O3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (2R,3R)-N-[3-[benzyl(ethyl)amino]propyl]-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CCN(CCCNC(=O)[C@@H]1CCC(=O)N(c2ccc(OC)cc2)C1c1ccc(F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H36FN3O3/c1-3-34(22-23-8-5-4-6-9-23)21-7-20-33-31(37)28-18-19-29(36)35(26-14-16-27(38-2)17-15-26)30(28)24-10-12-25(32)13-11-24/h4-6,8-17,28,30H,3,7,18-22H2,1-2H3,(H,33,37)/t28-,30?/m1/s1 |
| InChIKey | GZALGSHCPGBAGE-KFMIKNBQSA-N |
| XLogP | 5.35 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|