C28H36FN3O3 — CID 15994143
2-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-oxopiperidine-3-carboxamide (PubChem CID 15994143) has the molecular formula C28H36FN3O3 and a molecular weight of 481.61 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 15994143 |
| Molecular Formula | C28H36FN3O3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(N2C(=O)CCC(C(=O)NCCCN3CCC(C)CC3)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H36FN3O3/c1-20-14-18-31(19-15-20)17-3-16-30-28(34)25-12-13-26(33)32(23-8-10-24(35-2)11-9-23)27(25)21-4-6-22(29)7-5-21/h4-11,20,25,27H,3,12-19H2,1-2H3,(H,30,34) |
| InChIKey | NYXUZXLYMOPKAI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|