C27H35N3O5 — CID 92653033
(2S,3R)-1,2-bis(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide (PubChem CID 92653033) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is (2S,3R)-1,2-bis(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (2S,3R)-1,2-bis(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92653033 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (2S,3R)-1,2-bis(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(C2[C@H](C(=O)NCCCN3CCOCC3)CCC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H35N3O5/c1-33-22-8-4-20(5-9-22)26-24(27(32)28-14-3-15-29-16-18-35-19-17-29)12-13-25(31)30(26)21-6-10-23(34-2)11-7-21/h4-11,24,26H,3,12-19H2,1-2H3,(H,28,32)/t24-,26?/m1/s1 |
| InChIKey | UPTSSXWPAKXHFJ-RMVMEJTISA-N |
| XLogP | 3.03 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|