C9H12ClN — CID 140516226
1-chloro-2,3,4,6-tetrahydro-1H-quinolizine (PubChem CID 140516226) has the molecular formula C9H12ClN and a molecular weight of 169.66 g/mol. Its IUPAC name is 1-chloro-2,3,4,6-tetrahydro-1H-quinolizine.
| Compound Name | 1-chloro-2,3,4,6-tetrahydro-1H-quinolizine |
|---|---|
| PubChem CID | 140516226 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-chloro-2,3,4,6-tetrahydro-1H-quinolizine |
| SMILES | ClC1CCCN2CC=CC=C12 |
| InChI | InChI=1S/C9H12ClN/c10-8-4-3-7-11-6-2-1-5-9(8)11/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | NQDTYJIJNFGISK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|