C20H28O5 — CID 140517317
[(1R,2R,3R)-1-ethyl-3-hydroxy-2-[(1R)-1-hydroxy-5-phenylpentyl]-5-oxocyclopentyl] acetate (PubChem CID 140517317) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1R,2R,3R)-1-ethyl-3-hydroxy-2-[(1R)-1-hydroxy-5-phenylpentyl]-5-oxocyclopentyl] acetate.
| Compound Name | [(1R,2R,3R)-1-ethyl-3-hydroxy-2-[(1R)-1-hydroxy-5-phenylpentyl]-5-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 140517317 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1R,2R,3R)-1-ethyl-3-hydroxy-2-[(1R)-1-hydroxy-5-phenylpentyl]-5-oxocyclopentyl] acetate |
| SMILES | CC[C@]1(OC(C)=O)C(=O)C[C@@H](O)[C@H]1[C@H](O)CCCCc1ccccc1 |
| InChI | InChI=1S/C20H28O5/c1-3-20(25-14(2)21)18(24)13-17(23)19(20)16(22)12-8-7-11-15-9-5-4-6-10-15/h4-6,9-10,16-17,19,22-23H,3,7-8,11-13H2,1-2H3/t16-,17-,19-,20+/m1/s1 |
| InChIKey | KZXJRJJLOCGYLK-LFGUQSLTSA-N |
| XLogP | 2.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|