C11H11F9O2 — CID 140517608
1-[2,2-difluoro-2-(trifluoromethoxy)ethoxy]-3-ethenyl-2,4,5,6-tetrafluorocyclohexane (PubChem CID 140517608) has the molecular formula C11H11F9O2 and a molecular weight of 346.19 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(trifluoromethoxy)ethoxy]-3-ethenyl-2,4,5,6-tetrafluorocyclohexane.
| Compound Name | 1-[2,2-difluoro-2-(trifluoromethoxy)ethoxy]-3-ethenyl-2,4,5,6-tetrafluorocyclohexane |
|---|---|
| PubChem CID | 140517608 |
| Molecular Formula | C11H11F9O2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[2,2-difluoro-2-(trifluoromethoxy)ethoxy]-3-ethenyl-2,4,5,6-tetrafluorocyclohexane |
| SMILES | C=CC1C(F)C(F)C(F)C(OCC(F)(F)OC(F)(F)F)C1F |
| InChI | InChI=1S/C11H11F9O2/c1-2-4-5(12)7(14)8(15)9(6(4)13)21-3-10(16,17)22-11(18,19)20/h2,4-9H,1,3H2 |
| InChIKey | UHRZVVXFBHKBLA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|