C11H12F6O — CID 140517607
1-(3,3-difluoroprop-2-enoxy)-3-ethenyl-2,4,5,6-tetrafluorocyclohexane (PubChem CID 140517607) has the molecular formula C11H12F6O and a molecular weight of 274.20 g/mol. Its IUPAC name is 1-(3,3-difluoroprop-2-enoxy)-3-ethenyl-2,4,5,6-tetrafluorocyclohexane.
| Compound Name | 1-(3,3-difluoroprop-2-enoxy)-3-ethenyl-2,4,5,6-tetrafluorocyclohexane |
|---|---|
| PubChem CID | 140517607 |
| Molecular Formula | C11H12F6O |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(3,3-difluoroprop-2-enoxy)-3-ethenyl-2,4,5,6-tetrafluorocyclohexane |
| SMILES | C=CC1C(F)C(F)C(F)C(OCC=C(F)F)C1F |
| InChI | InChI=1S/C11H12F6O/c1-2-5-7(14)9(16)10(17)11(8(5)15)18-4-3-6(12)13/h2-3,5,7-11H,1,4H2 |
| InChIKey | XYRDAVSKBWASRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|