C11H15F3O — CID 101056705
1-prop-2-enoxy-1-(1,2,2-trifluoroethenyl)cyclohexane (PubChem CID 101056705) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-prop-2-enoxy-1-(1,2,2-trifluoroethenyl)cyclohexane.
| Compound Name | 1-prop-2-enoxy-1-(1,2,2-trifluoroethenyl)cyclohexane |
|---|---|
| PubChem CID | 101056705 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-prop-2-enoxy-1-(1,2,2-trifluoroethenyl)cyclohexane |
| SMILES | C=CCOC1(C(F)=C(F)F)CCCCC1 |
| InChI | InChI=1S/C11H15F3O/c1-2-8-15-11(9(12)10(13)14)6-4-3-5-7-11/h2H,1,3-8H2 |
| InChIKey | LWTDZBUVQQKKRZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|