C11H16F2O — CID 125452237
3,3-difluoro-7-oxaspiro[5.6]dodec-9-ene (PubChem CID 125452237) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is 3,3-difluoro-7-oxaspiro[5.6]dodec-9-ene.
| Compound Name | 3,3-difluoro-7-oxaspiro[5.6]dodec-9-ene |
|---|---|
| PubChem CID | 125452237 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3,3-difluoro-7-oxaspiro[5.6]dodec-9-ene |
| SMILES | FC1(F)CCC2(CCC=CCO2)CC1 |
| InChI | InChI=1S/C11H16F2O/c12-11(13)7-5-10(6-8-11)4-2-1-3-9-14-10/h1,3H,2,4-9H2 |
| InChIKey | GELIHJZHAHLZCF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|