C12H17F3O — CID 101459784
(2R,6R)-6-cyclohexyl-2-(trifluoromethyl)-3,6-dihydro-2H-pyran (PubChem CID 101459784) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is (2R,6R)-6-cyclohexyl-2-(trifluoromethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-6-cyclohexyl-2-(trifluoromethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 101459784 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2R,6R)-6-cyclohexyl-2-(trifluoromethyl)-3,6-dihydro-2H-pyran |
| SMILES | FC(F)(F)[C@H]1CC=C[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C12H17F3O/c13-12(14,15)11-8-4-7-10(16-11)9-5-2-1-3-6-9/h4,7,9-11H,1-3,5-6,8H2/t10-,11+/m0/s1 |
| InChIKey | DPCNDQWRAWWOLT-WDEREUQCSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|