C22H36F2O — CID 20599939
5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane (PubChem CID 20599939) has the molecular formula C22H36F2O and a molecular weight of 354.53 g/mol. Its IUPAC name is 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane.
| Compound Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane |
|---|---|
| PubChem CID | 20599939 |
| Molecular Formula | C22H36F2O |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane |
| SMILES | CCC/C=C/C1CCC(CCCCC2CCC(C=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C22H36F2O/c1-2-3-4-9-21-15-14-20(17-25-21)8-6-5-7-18-10-12-19(13-11-18)16-22(23)24/h4,9,16,18-21H,2-3,5-8,10-15,17H2,1H3/b9-4+ |
| InChIKey | WYCXFXYVPDUPOQ-RUDMXATFSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|