C18H28F2O2 — CID 20599488
2-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-5-propoxyoxane (PubChem CID 20599488) has the molecular formula C18H28F2O2 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-5-propoxyoxane.
| Compound Name | 2-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-5-propoxyoxane |
|---|---|
| PubChem CID | 20599488 |
| Molecular Formula | C18H28F2O2 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-[(E)-2-[4-(2,2-difluoroethenyl)cyclohexyl]ethenyl]-5-propoxyoxane |
| SMILES | CCCOC1CCC(/C=C/C2CCC(C=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C18H28F2O2/c1-2-11-21-17-10-9-16(22-13-17)8-7-14-3-5-15(6-4-14)12-18(19)20/h7-8,12,14-17H,2-6,9-11,13H2,1H3/b8-7+ |
| InChIKey | VPNSUKPDWIFIDV-BQYQJAHWSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|