C20H32F2O — CID 20599893
5-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-2-[(E)-prop-1-enyl]oxane (PubChem CID 20599893) has the molecular formula C20H32F2O and a molecular weight of 326.47 g/mol. Its IUPAC name is 5-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-2-[(E)-prop-1-enyl]oxane.
| Compound Name | 5-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-2-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 20599893 |
| Molecular Formula | C20H32F2O |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 5-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-2-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(CCC2CCC(CCC=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C20H32F2O/c1-2-4-19-14-13-18(15-23-19)12-11-17-9-7-16(8-10-17)5-3-6-20(21)22/h2,4,6,16-19H,3,5,7-15H2,1H3/b4-2+ |
| InChIKey | UTLNDVDOXNRBEB-DUXPYHPUSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|