C20H34F2O — CID 20599454
2-(2,2-difluoroethenyl)-5-[2-(4-pentylcyclohexyl)ethyl]oxane (PubChem CID 20599454) has the molecular formula C20H34F2O and a molecular weight of 328.49 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[2-(4-pentylcyclohexyl)ethyl]oxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[2-(4-pentylcyclohexyl)ethyl]oxane |
|---|---|
| PubChem CID | 20599454 |
| Molecular Formula | C20H34F2O |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[2-(4-pentylcyclohexyl)ethyl]oxane |
| SMILES | CCCCCC1CCC(CCC2CCC(C=C(F)F)OC2)CC1 |
| InChI | InChI=1S/C20H34F2O/c1-2-3-4-5-16-6-8-17(9-7-16)10-11-18-12-13-19(23-15-18)14-20(21)22/h14,16-19H,2-13,15H2,1H3 |
| InChIKey | ISVBHMBCMWMZJB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|